CAS 589-17-3
:4-Bromobenzyl chloride
Description:
4-Bromobenzyl chloride, with the CAS number 589-17-3, is an organic compound characterized by the presence of a bromine atom and a chlorine atom attached to a benzyl group. It is a colorless to pale yellow liquid at room temperature, exhibiting a distinctive aromatic odor. This compound is known for its reactivity, particularly in nucleophilic substitution reactions, where the chlorine atom can be replaced by various nucleophiles, making it useful in organic synthesis. Its molecular formula is C7H6BrCl, and it has a relatively low boiling point, which facilitates its use in various chemical reactions. 4-Bromobenzyl chloride is soluble in organic solvents such as ether and chloroform but is less soluble in water due to its hydrophobic aromatic structure. Safety precautions are necessary when handling this compound, as it can be harmful if inhaled or absorbed through the skin, and it may cause irritation to the eyes and respiratory system. Proper storage in a cool, dry place away from light is recommended to maintain its stability.
Formula:C7H6BrCl
InChI:InChI=1S/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2
InChI key:InChIKey=BSIIGUGKOPPTPZ-UHFFFAOYSA-N
SMILES:C(Cl)C1=CC=C(Br)C=C1
Synonyms:- 1-Bromo-4-(chloromethyl)-benzene
- 4-Bromo-alpha-chlorotoluene
- Benzene, 1-bromo-4-(chloromethyl)-
- Toluene, p-bromo-α-chloro-
- p-Bromo-α-chlorotoluene
- p-Bromobenzyl chloride
- α-Chloro-4-bromotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Bromobenzyl Chloride
CAS:Formula:C7H6BrClPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:205.484-Bromobenzyl chloride, 97%
CAS:<p>4-Bromobenzyl chloride is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy </p>Formula:C7H6BrClPurity:97%Color and Shape:White to gray, Crystals or powder or crystalline powder or fused solid or flakesMolecular weight:205.481-Bromo-4-(chloromethyl)benzene
CAS:Formula:C7H6BrClPurity:98%Color and Shape:SolidMolecular weight:205.47954-Bromobenzyl chloride
CAS:4-Bromobenzyl chlorideFormula:C7H6BrClPurity:≥95%Color and Shape: colourless to white fused solidMolecular weight:205.48g/mol




