
CAS 589-40-2
:sec-Butyl formate
Description:
Sec-butyl formate, with the CAS number 589-40-2, is an ester formed from sec-butanol and formic acid. It is a colorless liquid with a characteristic fruity odor, making it useful in flavoring and fragrance applications. The chemical formula for sec-butyl formate is C5H10O2, and it has a moderate boiling point, which allows it to be used in various industrial processes. This compound is known for its relatively low toxicity, but like many esters, it can be irritating to the skin and eyes. Sec-butyl formate is soluble in organic solvents and has limited solubility in water, which is typical for many esters. Its properties make it suitable for use as a solvent in chemical reactions and as an intermediate in organic synthesis. Additionally, it can be involved in reactions such as esterification and transesterification, contributing to its versatility in chemical manufacturing. Proper handling and storage are essential to ensure safety and maintain its integrity in applications.
Formula:C5H10O2
InChI:InChI=1S/C5H10O2/c1-3-5(2)7-4-6/h4-5H,3H2,1-2H3
InChI key:InChIKey=OAEQYDZVVPONKW-UHFFFAOYSA-N
SMILES:C(OC=O)(CC)C
Synonyms:- sec-Butyl alcohol, formate
- sec-Butyl formate
- Formic acid, sec-butyl ester
- 1-Methylpropyl formate
- Formic acid, 1-methylpropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.