
CAS 589-93-5
:2,5-Dimethylpyridine
Description:
2,5-Dimethylpyridine, with the CAS number 589-93-5, is a heterocyclic organic compound belonging to the pyridine family. It features a six-membered aromatic ring containing one nitrogen atom and two methyl groups attached to the second and fifth carbon atoms. This compound is a colorless to pale yellow liquid with a characteristic odor, and it is soluble in organic solvents while being less soluble in water. 2,5-Dimethylpyridine exhibits a boiling point that is higher than that of pyridine, reflecting its increased molecular weight due to the methyl substitutions. It is known for its use as a building block in organic synthesis and as a solvent in various chemical reactions. Additionally, it can act as a ligand in coordination chemistry and is involved in the production of agrochemicals and pharmaceuticals. Safety considerations include its flammability and potential health effects upon inhalation or skin contact, necessitating appropriate handling and storage measures.
Formula:C7H9N
InChI:InChI=1S/C7H9N/c1-6-3-4-7(2)8-5-6/h3-5H,1-2H3
InChI key:InChIKey=XWKFPIODWVPXLX-UHFFFAOYSA-N
SMILES:CC=1C=CC(C)=NC1
Synonyms:- 2,5-Dimethylpyridine
- 2,5-Lutidine =2,5-Dimethylpyridine
- Lutidine
- NSC 5089
- Pyridine, 2,5-dimethyl-
- 2,5-Lutidine
Sort by
Found 4 products.
2,5-Lutidine
CAS:Formula:C7H9NPurity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:107.16Ref: 3B-L0065
5ml31.00€25ml78.00€500ml649.00€Ref: 10-F242840
5ml66.00€100g776.00€25ml123.00€500ml882.00€Ref: 54-OR13598
neTo inquire