CAS 58909-39-0: Tetrahydro-2-methyl-3-thioxo-1,2,4-triazine-5,6-dione
Description:Tetrahydro-2-methyl-3-thioxo-1,2,4-triazine-5,6-dione, with the CAS number 58909-39-0, is a heterocyclic compound characterized by its triazine ring structure, which incorporates sulfur and oxygen functionalities. This compound features a tetrahydro configuration, indicating it has a saturated ring system, and includes a methyl group that contributes to its overall chemical properties. The presence of thioxo groups (sulfur-containing) and dione functionalities (two carbonyl groups) suggests that it may exhibit unique reactivity, potentially participating in various chemical reactions such as nucleophilic attacks or coordination with metal ions. Its structural characteristics may also impart biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound's solubility, stability, and reactivity can be influenced by its molecular structure, which may affect its applications in different fields. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C4H5N3O2S
InChI:InChI=1S/C4H5N3O2S/c1-7-4(10)5-2(8)3(9)6-7/h1H3,(H,6,9)(H,5,8,10)
InChI key:InChIKey=UMWWHOXOVPIGFD-UHFFFAOYSA-N
SMILES:O=C1NC(=S)N(NC1=O)C
- Synonyms:
- 1,2,4-Triazine-5,6-dione, tetrahydro-2-methyl-3-thioxo-
- 2,5-Dihydro-6-Hydroxy-2-Methyl-3-Mercapto-5-Oxo-1,2,3-Triazine
- 2,5-Dihydro-6-hydroxy-2-methyl-5-oxo-3-mercapto-1,2,4-triazine
- 2-Methyl-3-Thioxo-1,2,4-Triazinane-5,6-Dione
- 2-Methyl-3-sulfanylidene-1,2,4-triazinane-5,6-dione
- 2-Methyl-5,6-dioxo-1,2,5,6-tetrahydro-1,2,4-triazine-3-thiol
- 3-Mercapto-2-Methyl-5-oxo-6-Hydroxy-1,2,4-Triazine
- Ro 11-8390
- TTZ
- Tetrahydro-2-methyl-3-thioxo-1,2,4-triazine-5,6-dione
- See more synonyms
