CAS 5892-54-6: Dimethylcrocetin
Description:Dimethylcrocetin, with the CAS number 5892-54-6, is a chemical compound classified as a carotenoid, specifically a type of xanthophyll. It is characterized by its vibrant yellow to orange color, which is typical of carotenoids, and it is known for its antioxidant properties. Dimethylcrocetin is soluble in organic solvents but has limited solubility in water, which is common for many carotenoids. This compound is often studied for its potential health benefits, including its role in protecting cells from oxidative stress and its possible contributions to human health through dietary intake. Additionally, it may be used in various applications, including food coloring and cosmetics, due to its appealing hue and stability under certain conditions. As with many carotenoids, its stability can be affected by light, heat, and oxygen, which are important considerations in its storage and application. Overall, dimethylcrocetin represents a fascinating area of study within the field of natural pigments and their biological significance.
Formula:C22H28O4
InChI:InChI=1S/C22H28O4/c1-17(13-9-15-19(3)21(23)25-5)11-7-8-12-18(2)14-10-16-20(4)22(24)26-6/h7-16H,1-6H3/b8-7+,13-9+,14-10+,17-11+,18-12+,19-15+,20-16+
InChI key:InChIKey=OXNHRKGZZFWUQZ-QORFUXSJSA-N
SMILES:O=C(OC)C(=CC=CC(=CC=CC=C(C=CC=C(C(=O)OC)C)C)C)C
