CymitQuimica logo

CAS 58922-06-8

:

ethyl 4-amino-3,5-dibromobenzoate

Description:
Ethyl 4-amino-3,5-dibromobenzoate, with the CAS number 58922-06-8, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid derivative where the carboxylic acid group is esterified with ethanol, resulting in the ethyl ester. The compound is characterized by the presence of two bromine atoms at the 3 and 5 positions of the benzene ring, as well as an amino group at the para position (4). These substituents significantly influence its chemical properties, including its reactivity and solubility. Ethyl 4-amino-3,5-dibromobenzoate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The presence of bromine atoms can enhance its biological activity, while the amino group may participate in various chemical reactions, such as nucleophilic substitutions. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C9H9Br2NO2
InChI:InChI=1/C9H9Br2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3
InChI key:ROWXLRODWPSPTR-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc(c(c(c1)Br)N)Br
Found 3 products.