CAS 58928-83-9
:Hydrazine, (2-propylphenyl)-, hydrochloride (1:1)
Description:
Hydrazine, (2-propylphenyl)-, hydrochloride (1:1), with the CAS number 58928-83-9, is a chemical compound that belongs to the class of hydrazines, which are characterized by the presence of a hydrazine functional group (–NH–NH2). This specific compound is a hydrochloride salt, indicating that it is formed by the reaction of hydrazine with hydrochloric acid, resulting in a stable, water-soluble form. It typically appears as a white crystalline solid. Hydrazines are known for their reactivity and are often used in various applications, including as reducing agents, in the synthesis of pharmaceuticals, and in rocket propellants. The presence of the 2-propylphenyl group suggests that this compound may exhibit specific biological or chemical properties influenced by its aromatic structure. However, hydrazines can be toxic and potentially hazardous, necessitating careful handling and storage. As with all chemicals, it is essential to consult safety data sheets and relevant literature for detailed information regarding its properties, safety, and potential applications.
Formula:C9H14N2·ClH
InChI:InChI=1S/C9H14N2.ClH/c1-2-5-8-6-3-4-7-9(8)11-10;/h3-4,6-7,11H,2,5,10H2,1H3;1H
InChI key:InChIKey=BXZZKEYUVFYWGT-UHFFFAOYSA-N
SMILES:C(CC)C1=C(NN)C=CC=C1.Cl
Synonyms:- Hydrazine, (2-propylphenyl)-, monohydrochloride
- 2-Propylphenylhydrazine hydrochloride
- Hydrazine, (2-propylphenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
