CAS 5894-65-5
:N-tert-Butylbenzamide
Description:
N-tert-Butylbenzamide is an organic compound characterized by its amide functional group, where a tert-butyl group is attached to the nitrogen atom of benzamide. It has a molecular formula that reflects the presence of both aromatic and aliphatic components, contributing to its unique properties. This compound typically appears as a white to off-white solid and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. N-tert-Butylbenzamide is often utilized in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its structure allows for potential steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, it may exhibit specific thermal and chemical stability, making it suitable for various applications in chemical research and industry. Safety data indicates that, like many amides, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-11(2,3)12-10(13)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,12,13)
SMILES:CC(C)(C)N=C(c1ccccc1)O
Synonyms:- N-t-Butylbenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-tert-Butylbenzamide
CAS:Formula:C11H15NOPurity:99%(GC-MS);RGColor and Shape:SolidMolecular weight:177.247N-tert-Butylbenzamide
CAS:<p>N-tert-Butylbenzamide is a functional group with the chemical formula C6H10N2O. It has the amide, n-oxide and chloride functional groups. N-tert-Butylbenzamide is synthesized by reacting an aromatic hydrocarbon with an acid catalyst in the presence of aluminium. The reaction mechanism for this chemical is nucleophilic substitution. NMR spectra are used to identify the product formed by this reaction and to determine its purity. This efficient method of synthesis can be applied to other organic compounds as well.</p>Formula:C11H15NOPurity:Min. 95%Molecular weight:177.24 g/mol
