
CAS 5894-74-6
:1-[(7aR)-5,6,7a,8-Tetrahydro-7H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-7-yl]ethanone
Description:
1-[(7aR)-5,6,7a,8-Tetrahydro-7H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-7-yl]ethanone, with the CAS number 5894-74-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a quinoline and a benzodioxole moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and potential biological activity. The presence of the ethanone functional group suggests that it may exhibit ketone-like reactivity, potentially participating in various chemical reactions such as nucleophilic attacks or condensation reactions. Its stereochemistry, particularly the (7aR) designation, indicates specific spatial arrangements of atoms that can influence its interaction with biological targets, making it of interest in medicinal chemistry. Compounds with similar structures are often investigated for their pharmacological properties, including anti-inflammatory, analgesic, or neuroprotective effects. Overall, this substance represents a fascinating area of study within organic and medicinal chemistry due to its intricate structure and potential applications.
Formula:C19H17NO3
InChI:InChI=1S/C19H17NO3/c1-11(21)20-7-6-13-9-16-19(23-10-22-16)18-14-5-3-2-4-12(14)8-15(20)17(13)18/h2-5,9,15H,6-8,10H2,1H3/t15-/m1/s1
InChI key:InChIKey=XVIHBNVDAPQBRH-OAHLLOKOSA-N
SMILES:C(C)(=O)N1[C@]2(C=3C(=C4C(=CC3CC1)OCO4)C=5C(C2)=CC=CC5)[H]
Synonyms:- Anonaine, N-acetyl-
- 5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline, 7-acetyl-6,7,7a,8-tetrahydro-, (7aR)-
- Ethanone, 1-[(7aR)-5,6,7a,8-tetrahydro-7H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-7-yl]-
- 5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline, 7-acetyl-6,7,7a,8-tetrahydro-, (R)-
- 6aβ-Noraporphine, 6-acetyl-1,2-(methylenedioxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Acetylanonaine
CAS:N-Acetylanonaine may be used as a substrate for the identification, differentiation, and characterization of aminoacylase(s)/amidohydrolase(s).Formula:C19H17NO3Color and Shape:SolidMolecular weight:307.34
