CAS 58952-80-0
:N-[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-N-methylacetamide
Description:
N-[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-N-methylacetamide, with the CAS number 58952-80-0, is a chemical compound characterized by its amide functional group and a chiral center, which contributes to its stereochemistry. This compound features a hydroxyl group attached to a phenyl ring, indicating potential for hydrogen bonding and influencing its solubility and reactivity. The presence of both hydroxyl and amide groups suggests that it may exhibit polar characteristics, making it soluble in polar solvents. Its structure implies potential biological activity, possibly interacting with biological receptors or enzymes due to the presence of the hydroxyl groups. The compound may also be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, given its structural features that could influence pharmacokinetics and pharmacodynamics. Overall, its unique combination of functional groups and stereochemistry makes it a subject of interest for further research in various chemical and biological applications.
Formula:C11H15NO3
InChI:InChI=1/C11H15NO3/c1-8(13)12(2)7-11(15)9-4-3-5-10(14)6-9/h3-6,11,14-15H,7H2,1-2H3/t11-/m0/s1
SMILES:CC(=O)N(C)C[C@@H](c1cccc(c1)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenylephrine Impurity 48 (N-Acetyl Phenylephrine)
CAS:Formula:C11H15NO3Color and Shape:White To Off-White SolidMolecular weight:209.25(R)-N-Acetyl Phenylephrine
CAS:Controlled ProductApplications N-Acetyl derivative of R-Phenylephrine (P320640), used in the synthesis of Phenylephrine.
References Wouters, I., et al.: J. Pharma. Biomed. Anal., 2, 481 (1984),Formula:C11H15NO3Color and Shape:NeatMolecular weight:209.24N-Acetylphenylephrine
CAS:Please enquire for more information about N-Acetylphenylephrine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H15NO3Purity:Min. 95%Molecular weight:209.24 g/mol




