CAS 58954-39-5

5-phenyl-6H-1,3,4-thiadiazin-2-amine

Description:

5-phenyl-6H-1,3,4-thiadiazin-2-amine is a heterocyclic compound characterized by the presence of a thiadiazine ring, which incorporates sulfur and nitrogen atoms in its structure. This compound features a phenyl group attached to the thiadiazine, contributing to its aromatic properties. The presence of the amino group (-NH2) at the 2-position of the thiadiazine ring enhances its reactivity and potential for forming various derivatives. Generally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry. They can participate in hydrogen bonding due to the amino group, influencing their solubility and interaction with biological targets. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents with antimicrobial or anti-inflammatory properties. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the phenyl group and the overall molecular conformation. As with many heterocycles, the synthesis and characterization of 5-phenyl-6H-1,3,4-thiadiazin-2-amine are crucial for understanding its properties and potential applications.

Formula: C₉H₉N₃S

InChI: InChI=1/C9H9N3S/c10-9-12-11-8(6-13-9)7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12)

SMILES: c1ccc(cc1)C1=NNC(=N)SC1

Synonyms:

• 2H-1,3,4-thiadiazin-2-imine, 3,6-dihydro-5-phenyl-
• 6H-1,3,4-Thiadiazin-2-amine, 5-phenyl-
• 5-Phenyl-6H-1,3,4-thiadiazin-2-amine