CymitQuimica logo

CAS 5896-92-4

:

2-{5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl}-1H-isoindole-1,3(2H)-dione

Description:
The chemical substance known as 2-{5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl}-1H-isoindole-1,3(2H)-dione, with the CAS number 5896-92-4, is a synthetic organic compound characterized by its complex structure, which includes an isoindole core and a phenoxy group. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of hydroxymethyl and amino functional groups. These functional groups can contribute to its reactivity and potential biological activity, making it of interest in medicinal chemistry. The isoindole moiety may impart specific pharmacological properties, while the phenoxy and pentyl substituents can affect its lipophilicity and interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in areas requiring compounds with specific binding affinities or biological activities. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic efficacy would be necessary to fully understand its potential uses.
Formula:C20H22N2O4
InChI:InChI=1/C20H22N2O4/c21-15-8-9-18(14(12-15)13-23)26-11-5-1-4-10-22-19(24)16-6-2-3-7-17(16)20(22)25/h2-3,6-9,12,23H,1,4-5,10-11,13,21H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.