CAS 58976-46-8
:(D-trp8)-somatostatin
Description:
(D-Trp8)-somatostatin is a synthetic analog of somatostatin, a peptide hormone that plays a crucial role in inhibiting the secretion of various other hormones and regulating numerous physiological processes, including growth hormone release and gastrointestinal function. This compound is characterized by its specific amino acid sequence, which includes a substitution of D-tryptophan at the eighth position, enhancing its stability and potency compared to the natural form. The molecular structure of (D-Trp8)-somatostatin consists of 14 amino acids, and it exhibits a cyclic conformation that is essential for its biological activity. Its mechanism of action primarily involves binding to somatostatin receptors, which are G-protein coupled receptors, leading to a decrease in hormone secretion. This compound has potential therapeutic applications, particularly in treating conditions such as acromegaly, certain types of tumors, and gastrointestinal disorders. Additionally, its pharmacokinetic properties, including improved resistance to enzymatic degradation, make it a valuable candidate for clinical use.
Formula:C76H104N18O19S2
InChI:InChI=1/C76H104N18O19S2/c1-41(79)64(100)82-37-61(99)83-58-39-114-115-40-59(76(112)113)92-72(108)57(38-95)91-75(111)63(43(3)97)94-71(107)54(33-46-23-11-6-12-24-46)90-74(110)62(42(2)96)93-66(102)51(28-16-18-30-78)84-69(105)55(34-47-36-81-49-26-14-13-25-48(47)49)88-68(104)53(32-45-21-9-5-10-22-45)86-67(103)52(31-44-19-7-4-8-20-44)87-70(106)56(35-60(80)98)89-65(101)50(85-73(58)109)27-15-17-29-77/h4-14,19-26,36,41-43,50-59,62-63,81,95-97H,15-18,27-35,37-40,77-79H2,1-3H3,(H2,80,98)(H,82,100)(H,83,99)(H,84,105)(H,85,109)(H,86,103)(H,87,106)(H,88,104)(H,89,101)(H,90,110)(H,91,111)(H,92,108)(H,93,102)(H,94,107)(H,112,113)/t41-,42?,43?,50-,51-,52-,53-,54-,55+,56-,57-,58-,59-,62-,63-/m0/s1
Synonyms:- (D-Trp8)-Somatostatin-14
- H-Ala-Gly-Cys-Lys-Asn-Phe-Phe-D-Trp-Lys-Thr-Phe-Thr-Ser-Cys-OH (Disulfide bond)
- Ala-Gly-Cys-Lys-Asn-Phe-Phe-D-Trp-Lys-Thr-Phe-Thr-Ser-Cys
- somatostatin, Trp(8)-
- ALA-GLY-CYS-LYS-ASN-PHE-PHE-D-TRP-LYS-THR-PHE-THR-SER-CYS (DISULFIDE BRIDGE:CYS3-CYS14)
- H-ALA-GLY-CYS-LYS-ASN-PHE-PHE-D-TRP-LYS-THR-PHE-THR-SER-CYS-OH
- Somatostatin (sheep), 8-D-tryptophan-
- [DTRP8] SRIF
- [D-Trp8]somatotropin release-inhibiting factor
- L-Ala-Gly-L-Cys(1)-L-Lys-L-Asp(NH2)-L-Phe-L-Phe-D-Trp-L-Lys-L-Thr-L-Phe-L-Thr-L-Ser-L-Cys(1)-OH
- [D-TRP8]-SOMATOSTATIN
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(D-Trp⁸)-Somatostatin-14
CAS:This somatostatin analog is 6-8 times more potent than somatostatin in inhibiting the release of growth hormone, glucagon, and insulin. It may better resist degradation by biological fluids.Formula:C76H104N18O19S2Purity:95.2%Molecular weight:1637.9[D-Trp8]-Somatostatin
CAS:This product contains disulfide bonds between Cys3-Cys14. Somatostatin is a hormone that regulates the release of growth hormones, insulin, and glucagon from the pancreas. It is widely expressed throughout the body for example in the gastrointestinal (GI) tract, hypothalamus, pancreas and the central nervous system. In the central nervous system somatostatin plays a role in neurotransmission modification and it has also demonstrated to be effective against a number of cancers such as squamous carcinoma.
Formula:C76H104N18O19S2Purity:Min. 95%Molecular weight:1,637.9 g/mol(D-Trp8)-Somatostatin-14 trifluoroacetate salt
CAS:Please enquire for more information about (D-Trp8)-Somatostatin-14 trifluoroacetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C76H104N18O19S2Purity:Min. 95%Molecular weight:1,637.88 g/molRef: 3D-FT108921
Discontinued product

