CAS 58976-65-1
:Glutamic acid-N,N-diacetic acid
Description:
Glutamic acid-N,N-diacetic acid, also known as EDG (ethylenediamine-N,N-diacetic acid), is a chelating agent that features a structure derived from glutamic acid, an amino acid. This compound is characterized by its ability to form stable complexes with metal ions, making it useful in various applications, including agriculture, pharmaceuticals, and analytical chemistry. It is a white crystalline solid that is soluble in water, which enhances its utility in aqueous environments. The presence of multiple carboxylic acid groups in its structure allows it to effectively bind to divalent and trivalent metal ions, thereby preventing precipitation and facilitating their transport in biological systems. Additionally, glutamic acid-N,N-diacetic acid is considered environmentally friendly due to its biodegradable nature. Its chelating properties are leveraged in various formulations, including those aimed at improving nutrient availability in soil and enhancing the efficacy of certain drugs. Overall, this compound plays a significant role in both industrial and research settings due to its versatile chemical behavior.
Formula:C9H13NO8
InChI:InChI=1S/C9H13NO8/c11-6(12)2-1-5(9(17)18)10(3-7(13)14)4-8(15)16/h5H,1-4H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t5-/m0/s1
InChI key:InChIKey=VCVKIIDXVWEWSZ-YFKPBYRVSA-N
SMILES:N([C@@H](CCC(O)=O)C(O)=O)(CC(O)=O)CC(O)=O
Synonyms:- <span class="text-smallcaps">L</span>-Glutamic acid, N,N-bis(carboxymethyl)-
- <span class="text-smallcaps">L</span>-Glutamic acid, N,N-diacetyl-
- <span class="text-smallcaps">L</span>-Glutamic acid-N,N-di(acetic acid)
- Dicarboxymethyl-<span class="text-smallcaps">L</span>-glutamic acid
- Dissolvine 47S
- Dissolvine GL 45SLA
- Dissolvine GL 74
- Glutamic acid, N,N-bis(carboxymethyl)-, <span class="text-smallcaps">L</span>-
- Glutamic acid-N,N-diacetic acid
- N,N-Bis(carboxymethyl) <span class="text-smallcaps">L</span>-glutamic acid
- N,N-Diacetyl-<span class="text-smallcaps">L</span>-glutamic acid
- N,N-bis(carboxymethyl)glutamic acid
- Glutamic acid, N,N-bis(carboxymethyl)-, L-
- N,N-Bis(carboxymethyl) L-glutamic acid
- L-Glutamic acid, N,N-bis(carboxymethyl)-
- L-Glutamic acid-N,N-di(acetic acid)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N,N-Bis(carboxymethyl)-L-glutamic acid
CAS:<p>N,N-bis(Carboxymethyl)-L-glutamic acid is a synthetic compound that functions as a disinfectant. It has been shown to be effective against bacteria and fungi in vitro, with an efficacy of over 90%. N,N-bis(Carboxymethyl)-L-glutamic acid is used as a treatment for tumors due to its ability to penetrate the tumor cells and inhibit fatty acid uptake. This compound also prevents the formation of new blood vessels by inhibiting the synthesis of DNA and RNA. N,N-bis(Carboxymethyl)-L-glutamic acid can be used in coatings for metals or metal surfaces that are exposed to water or air because it is biodegradable and noncorrosive.</p>Formula:C9H13NO8Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:263.2 g/mol
