CAS 58980-52-2

2-[(2-hydroxyethyl)sulfanyl]benzoic acid

Description:

2-[(2-Hydroxyethyl)sulfanyl]benzoic acid, with the CAS number 58980-52-2, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a 2-hydroxyethylthio group. This compound features a benzene ring attached to a carboxylic acid group (-COOH) and a thioether functional group (-S-), which is further substituted with a hydroxyethyl group (-CH2CH2OH). The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may enhance its reactivity in various chemical reactions. The thioether linkage can impart unique properties, such as increased nucleophilicity and potential for forming coordination complexes. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural characteristics suggest potential applications in drug development, particularly in the design of compounds with specific interactions in biological systems. As with many organic compounds, its stability, reactivity, and solubility will depend on environmental conditions such as pH and temperature.

Formula: C₉H₁₀O₃S

InChI: InChI=1/C9H10O3S/c10-5-6-13-8-4-2-1-3-7(8)9(11)12/h1-4,10H,5-6H2,(H,11,12)

SMILES: c1ccc(c(c1)C(=O)O)SCCO

2-[(2-Hydroxyethyl)sulfanyl]benzoic acid

CAS: 58980-52-2

Versatile small molecule scaffold

Formula: C₉H₁₀O₃S

Purity: Min. 95%

Molecular weight: 198.24 g/mol

Ref: 3D-ICA98052