CAS 5900-00-5

4-Bromo-1-phenyl-1H-pyrazol-5-amine

Description:

4-Bromo-1-phenyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a phenyl group at the 1-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic phenyl group. It is often used in medicinal chemistry and research due to its potential biological activity, including anti-inflammatory and analgesic properties. The amine functional group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound's structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage and disposal methods are essential to ensure safety in laboratory settings.

Formula: C₉H₈BrN₃

InChI: InChI=1S/C9H8BrN3/c10-8-6-12-13(9(8)11)7-4-2-1-3-5-7/h1-6H,11H2

InChI key: InChIKey=VIFCFRDZUNAODA-UHFFFAOYSA-N

SMILES: NC=1N(N=CC1Br)C2=CC=CC=C2

Synonyms:

• 1H-Pyrazol-5-amine, 4-bromo-1-phenyl-
• 4-Bromo-1-phenyl-1H-pyrazol-5-amine
• Pyrazole, 5-amino-4-bromo-1-phenyl-

4-Bromo-1-phenyl-1H-pyrazol-5-amine

CAS: 5900-00-5

Versatile small molecule scaffold

Formula: C₉H₈BrN₃

Purity: Min. 95%

Molecular weight: 238.08 g/mol

Ref: 3D-FAA90000