CAS 5900-56-1
:2-(acetylamino)-4-chlorobenzoic acid
Description:
2-(Acetylamino)-4-chlorobenzoic acid, with the CAS number 5900-56-1, is an organic compound that belongs to the class of benzoic acids. It features a chlorinated aromatic ring, specifically with a chlorine substituent at the para position relative to the carboxylic acid group. The compound contains an acetylamino group, which contributes to its solubility and reactivity. It is typically a white to off-white crystalline solid, and its molecular structure includes both an amide and a carboxylic acid functional group, which can participate in various chemical reactions, such as acylation and amidation. This compound is often used in pharmaceutical research and development due to its potential biological activity. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C9H8ClNO3
InChI:InChI=1/C9H8ClNO3/c1-5(12)11-8-4-6(10)2-3-7(8)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)
Synonyms:- 2-Acetamido-4-chlorobenzoic acid
- Benzoic Acid, 2-(Acetylamino)-4-Chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Acetamido-4-chlorobenzoic acid
CAS:2-Acetamido-4-chlorobenzoic acid is a synthetic drug that is used as an ester in pharmaceuticals. It was first synthesized in 1958 and has been shown to have tuberculostatic activity, but it does not bind to DNA or RNA. 2-Acetamido-4-chlorobenzoic acid inhibits protein synthesis by binding to the 30S ribosomal subunit, inhibiting peptidyl transferase. It also inhibits bacterial growth by binding to the 50S ribosomal subunit and competes with aminobenzoic acid for binding sites on the enzyme alcohol dehydrogenase. 2-Acetamido-4-chlorobenzoic acid is used in veterinary medicine as a treatment for Mycobacterium avium complex (MAC), which causes chronic respiratory disease in cats. The drug has also been shown to inhibit cancer cells by interfering with cell division at the G2/MFormula:C9H8ClNO3Purity:Min. 95%Molecular weight:213.62 g/mol

