CAS 59005-83-3
:phe-gly-phe-gly
Description:
The chemical substance known as "phe-gly-phe-gly," with the CAS number 59005-83-3, is a peptide composed of the amino acids phenylalanine (Phe) and glycine (Gly). This compound typically exhibits characteristics common to peptides, such as being soluble in water and having a relatively low molecular weight. The presence of phenylalanine contributes to its hydrophobic properties, while glycine, being the simplest amino acid, adds flexibility to the peptide chain. Peptides like this one can participate in various biological activities, including acting as signaling molecules or influencing protein structure and function. The specific sequence of amino acids can affect the peptide's conformation and interactions with other biomolecules. Additionally, this compound may have applications in biochemistry and pharmaceuticals, particularly in studies related to protein synthesis, drug design, or as potential therapeutic agents. However, detailed studies would be necessary to fully understand its biological roles and potential applications.
Formula:C22H26N4O5
InChI:InChI=1/C22H26N4O5/c23-17(11-15-7-3-1-4-8-15)21(30)24-13-19(27)26-18(22(31)25-14-20(28)29)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14,23H2,(H,24,30)(H,25,31)(H,26,27)(H,28,29)
SMILES:c1ccc(cc1)CC(C(=NCC(=NC(Cc1ccccc1)C(=NCC(=O)O)O)O)O)N
Synonyms:- H-Phe-Gly-Phe-Gly-Oh
- Phenylalanylglycylphenylalanylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Phe-Gly-Phe-Gly-OH
CAS:H-Phe-Gly-Phe-Gly-OH is a neutral, uv absorbing molecule. It can be found as a tetrapeptide sequence and in the form of isomers. H-Phe-Gly-Phe-Gly-OH is also known as Ileahexocin. The chemical ionization and matrix assisted laser desorption/ionization techniques have been used to detect this molecule in different matrices. H-Phe-Gly-Phe-Gly-OH has been shown to inhibit fatty acid synthesis, which may be due to its inhibition of the enzyme acetyl coenzyme A carboxylase (ACC). This molecule has also been shown to inhibit tripeptide synthesis, which may be due to its inhibition of the enzyme dipeptidyl peptidase IV (DPIV).Formula:C22H26N4O5Purity:Min. 95%Color and Shape:PowderMolecular weight:426.47 g/mol

