CAS 590350-41-7
:7-Chloro-8-methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarboxylic acid
Description:
7-Chloro-8-methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarboxylic acid, with the CAS number 590350-41-7, is a synthetic organic compound belonging to the quinoline family. This compound features a quinoline core, which is characterized by a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chloro group at the 7-position and a methyl group at the 8-position contributes to its unique chemical properties, while the 4-(1-methylpropyl)phenyl substituent enhances its lipophilicity and potential biological activity. The carboxylic acid functional group at the 4-position of the quinoline ring is significant for its reactivity and solubility in polar solvents. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses.
Formula:C21H20ClNO2
InChI:InChI=1S/C21H20ClNO2/c1-4-12(2)14-5-7-15(8-6-14)19-11-17(21(24)25)16-9-10-18(22)13(3)20(16)23-19/h5-12H,4H2,1-3H3,(H,24,25)
InChI key:InChIKey=LIPSTZJOPWNOMD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(CC)C)C=C3)C(C)=C(Cl)C=C2
Synonyms:- 4-Quinolinecarboxylic acid, 7-chloro-8-methyl-2-[4-(1-methylpropyl)phenyl]-
- 7-Chloro-8-methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.