CAS 590353-09-6

5-(2-cyclohexylethyl)-4-methyl-4H-1,2,4-triazole-3-thiol

Description:

5-(2-Cyclohexylethyl)-4-methyl-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a thiol functional group (-SH) at the 3-position of the triazole, contributing to its potential reactivity and ability to form disulfide bonds. The presence of a cyclohexylethyl group at the 5-position enhances its hydrophobic characteristics, which may influence its solubility and biological activity. The methyl group at the 4-position adds to the steric bulk of the molecule. This compound may exhibit various biological activities, including potential antifungal or antimicrobial properties, due to the presence of the triazole and thiol functionalities. Its unique structure allows for interactions with biological targets, making it of interest in medicinal chemistry and drug development. As with many triazole derivatives, it may also be involved in coordination chemistry, forming complexes with metal ions.

Formula: C₁₁H₁₉N₃S

InChI: InChI=1/C11H19N3S/c1-14-10(12-13-11(14)15)8-7-9-5-3-2-4-6-9/h9H,2-8H2,1H3,(H,13,15)

SMILES: Cn1c(CCC2CCCCC2)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-(2-cyclohexylethyl)-4-methyl-

5-(2-cyclohexylethyl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 590353-09-6

Formula: C₁₁H₁₉N₃S

Purity: 95.0%

Molecular weight: 225.35

Ref: 10-F307738