CAS 590360-23-9

5-Chloro-2-[(4-methylphenyl)methoxy]benzaldehyde

Description:

5-Chloro-2-[(4-methylphenyl)methoxy]benzaldehyde is an organic compound characterized by its aromatic structure, which includes a chloro substituent and a methoxy group attached to a benzaldehyde moiety. The presence of the chloro group introduces a degree of electron-withdrawing character, influencing the compound's reactivity and polarity. The methoxy group, which is an ether functional group, enhances the compound's solubility in organic solvents and can participate in various chemical reactions, such as nucleophilic substitutions. The para-methylphenyl group contributes to the overall hydrophobic character and steric bulk of the molecule, potentially affecting its interactions in biological systems or during synthetic processes. This compound may be of interest in pharmaceutical research and organic synthesis due to its unique structural features, which could lead to diverse applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and spectral data, would need to be referenced from experimental data for precise applications.

Formula: C₁₅H₁₃ClO₂

InChI: InChI=1S/C15H13ClO2/c1-11-2-4-12(5-3-11)10-18-15-7-6-14(16)8-13(15)9-17/h2-9H,10H2,1H3

InChI key: InChIKey=AJWAGBRTJHZGCV-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C)C=C1)C2=C(C=O)C=C(Cl)C=C2

Synonyms:

• 5-Chloro-2-[(4-methylphenyl)methoxy]benzaldehyde
• Benzaldehyde, 5-Chloro-2-[(4-Methylphenyl)Methoxy]-

5-chloro-2-[(4-methylbenzyl)oxy]benzaldehyde

CAS: 590360-23-9

Formula: C₁₅H₁₃ClO₂

Purity: 95.0%

Molecular weight: 260.72

Ref: 10-F307574