CAS 590371-38-3
:3-(trifluoromethyl)pyridine-4-carboxylic acid
Description:
3-(Trifluoromethyl)pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a trifluoromethyl group and a carboxylic acid functional group. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and polarity. The carboxylic acid group (-COOH) contributes to the compound's acidity and can participate in various chemical reactions, such as esterification and amidation. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid. Its unique structure makes it of interest in medicinal chemistry and agrochemicals, where it may serve as a building block for the synthesis of more complex molecules. Additionally, the presence of fluorine atoms can enhance the compound's biological activity and stability. Overall, 3-(trifluoromethyl)pyridine-4-carboxylic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C7H4F3NO2
InChI:InChI=1/C7H4F3NO2/c8-7(9,10)5-3-11-2-1-4(5)6(12)13/h1-3H,(H,12,13)
SMILES:c1cncc(c1C(=O)O)C(F)(F)F
Synonyms:- 3-(Trifluoromethyl)isonicotinic acid
- 4-Pyridinecarboxylic Acid, 3-(Trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Trifluoromethyl)pyridine-4-carboxylic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H4F3NO2Purity:95%Molecular weight:191.113-(Trifluoromethyl)isonicotinic acid
CAS:3-(Trifluoromethyl)isonicotinic acidFormula:C7H4F3NO2Purity:99%Color and Shape:PowderMolecular weight:191.11g/mol3-(Trifluoromethyl)pyridine-4-carboxylic acid
CAS:Formula:C7H4F3NO2Purity:98%Color and Shape:SolidMolecular weight:191.109



