CAS 590371-90-7
:4-chloro-3-iodoquinoline
Description:
4-Chloro-3-iodoquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of chlorine and iodine substituents at the 4 and 3 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to brownish color and is sparingly soluble in water but more soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with halogenated quinoline derivatives. Additionally, 4-chloro-3-iodoquinoline may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal measures should be observed.
Formula:C9H5ClIN
InChI:InChI=1S/C9H5ClIN/c10-9-6-3-1-2-4-8(6)12-5-7(9)11/h1-5H
SMILES:c1ccc2c(c1)c(c(cn2)I)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-3-iodoquinoline
CAS:Formula:C9H5ClINPurity:97%Color and Shape:SolidMolecular weight:289.50024-Chloro-3-iodoquinoline
CAS:Formula:C9H5ClINPurity:98%Color and Shape:No data available.Molecular weight:289.54-Chloro-3-iodo-quinoline
CAS:4-Chloro-3-iodo-quinoline is a ligand that has been shown to have agonistic activity with the immune system. It has been demonstrated to be an adjuvant in vaccines, and has been shown to be effective against furan, chlorine, and azide. 4-Chloro-3-iodo-quinoline is structurally related to 3-(trifluoromethyl)quinoline, which is a pharmacological agent used for the treatment of rheumatoid arthritis. The pharmacological effects of 4-chloro-3-iodo quinoline may be due to its ability to bind with toll like receptor.
Formula:C9H5ClINPurity:Min. 95%Molecular weight:289.5 g/mol



