CAS 590376-39-9

5-(2-phenylethyl)-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(2-Phenylethyl)-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which contributes to its biological activity. This compound features a thione functional group, which is a sulfur-containing moiety that can influence its reactivity and interaction with biological targets. The presence of the phenylethyl and prop-2-en-1-yl substituents enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. The triazole ring is known for its role in various pharmacological applications, including antifungal and antimicrobial properties. Additionally, the compound may exhibit specific stereochemistry due to the presence of double bonds, which can impact its biological activity and interactions. Overall, this compound's structural characteristics suggest potential utility in medicinal chemistry, although specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₃H₁₅N₃S

InChI: InChI=1/C13H15N3S/c1-2-10-16-12(14-15-13(16)17)9-8-11-6-4-3-5-7-11/h2-7H,1,8-10H2,(H,15,17)

SMILES: C=CCn1c(CCc2ccccc2)nnc1S

Synonyms:

• 4-Allyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-thiol

4-allyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-thiol

CAS: 590376-39-9

Formula: C₁₃H₁₅N₃S

Purity: 95.0%

Molecular weight: 245.34

Ref: 10-F307730

4-Allyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-thiol

Controlled Product

CAS: 590376-39-9

Formula: C₁₃H₁₅N₃S

Color and Shape: Neat

Molecular weight: 245.34

Ref: TR-A614753