CAS 590376-41-3

4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-thiol

Description:

4-Ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethyl group and a phenylethyl substituent, contributing to its unique properties and potential applications. The presence of a thiol (-SH) group is significant, as it can participate in various chemical reactions, including nucleophilic attacks and the formation of disulfide bonds. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. Its molecular structure suggests potential interactions with biological targets, and its solubility and stability can vary based on environmental conditions. As with many triazole derivatives, it may also possess properties that allow it to act as a ligand in coordination chemistry. Overall, 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-thiol is a versatile compound with potential applications in medicinal chemistry and materials science.

Formula: C₁₂H₁₅N₃S

InChI: InChI=1/C12H15N3S/c1-2-15-11(13-14-12(15)16)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,14,16)

SMILES: CCn1c(CCc2ccccc2)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-ethyl-5-(2-phenylethyl)-

4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-thiol

CAS: 590376-41-3

Formula: C₁₂H₁₅N₃S

Purity: 95.0%

Molecular weight: 233.33

Ref: 10-F307729