CAS 590376-72-0

2-(4-chloro-2-formylphenoxy)acetamide

Description:

2-(4-chloro-2-formylphenoxy)acetamide is a chemical compound characterized by its unique structural features, which include a chloro-substituted aromatic ring and an acetamide functional group. The presence of the 4-chloro substituent enhances its reactivity and may influence its biological activity. The formyl group contributes to its potential as a reactive intermediate in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the acetamide moiety. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit interesting biological properties. Additionally, the presence of both electron-withdrawing and electron-donating groups in its structure may affect its electronic properties, influencing its reactivity and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, given the potential hazards associated with its components.

Formula: C₉H₈ClNO₃

InChI: InChI=1/C9H8ClNO3/c10-7-1-2-8(6(3-7)4-12)14-5-9(11)13/h1-4H,5H2,(H2,11,13)

SMILES: c1cc(c(cc1Cl)C=O)OCC(=N)O

Synonyms:

• Acetamide, 2-(4-Chloro-2-Formylphenoxy)-

2-(4-Chloro-2-formylphenoxy)acetamide

CAS: 590376-72-0

Versatile small molecule scaffold

Formula: C₉H₈ClNO₃

Purity: Min. 95%

Molecular weight: 213.62 g/mol

Ref: 3D-QYA37672