CAS 590376-88-8

5-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 590376-88-8, is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a thiophenyl group, which contributes to its aromatic properties and potential biological activity. The presence of a thione functional group (a sulfur atom double-bonded to a carbon atom) enhances its reactivity and may influence its interactions in biological systems. The ethyl and methyl substituents on the thiophene ring can affect the compound's solubility and lipophilicity, potentially impacting its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to understand its potential applications.

Formula: C₁₀H₁₃N₃S₂

InChI: InChI=1/C10H13N3S2/c1-4-7-6(2)15-5-8(7)9-11-12-10(14)13(9)3/h5H,4H2,1-3H3,(H,12,14)

SMILES: CCc1c(C)scc1c1nnc(n1C)S

5-(4-ethyl-5-methyl-3-thienyl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 590376-88-8

Formula: C₁₀H₁₃N₃S₂

Purity: 95.0%

Molecular weight: 239.36

Ref: 10-F307687