CAS 590395-57-6

2-(2-formyl-6-methoxyphenoxy)propanoic acid

Description:

2-(2-formyl-6-methoxyphenoxy)propanoic acid, identified by its CAS number 590395-57-6, is an organic compound characterized by its unique structural features. It contains a propanoic acid moiety, which contributes to its acidic properties, and a phenoxy group that is substituted with a formyl and a methoxy group. This compound is likely to exhibit both hydrophilic and lipophilic characteristics due to the presence of polar functional groups (the carboxylic acid and the formyl group) alongside the methoxy group, which can influence its solubility in various solvents. The presence of the aromatic ring may also impart stability and potential reactivity in various chemical reactions, such as electrophilic substitution. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its specific properties, such as melting point, boiling point, and reactivity, would need to be determined through experimental methods or detailed literature review for practical applications.

Formula: C₁₁H₁₂O₅

InChI: InChI=1/C11H12O5/c1-7(11(13)14)16-10-8(6-12)4-3-5-9(10)15-2/h3-7H,1-2H3,(H,13,14)

SMILES: CC(C(=O)O)Oc1c(cccc1OC)C=O

2-(2-Formyl-6-methoxyphenoxy)propanoic Acid

Controlled Product

CAS: 590395-57-6

Applications 2-(2-Formyl-6-methoxyphenoxy)propanoic Acid has been used as a reactant for the preparation of leukotriene B4 antagonists.
References Ando, K., et. al.: Org. Biomol. Chem., 6, 296 (2008)

Formula: C₁₁H₁₂O₅

Color and Shape: Neat

Molecular weight: 224.21

Ref: TR-F700780

2-(2-Formyl-6-methoxyphenoxy)propanoic Acid

CAS: 590395-57-6

Versatile small molecule scaffold

Formula: C₁₁H₁₂O₅

Purity: Min. 95%

Molecular weight: 224.21 g/mol

Ref: 3D-QYA39557