CAS 590395-58-7

2-(2-Chloro-4-formyl-6-methoxyphenoxy)propanoic acid

Description:

2-(2-Chloro-4-formyl-6-methoxyphenoxy)propanoic acid, with the CAS number 590395-58-7, is a chemical compound characterized by its unique structural features, which include a chloro substituent, a formyl group, and a methoxy group attached to a phenoxy moiety. This compound is typically classified as an aromatic carboxylic acid due to the presence of the carboxylic acid functional group (-COOH). The chloro group introduces reactivity and potential for further chemical modifications, while the methoxy group can influence the compound's solubility and electronic properties. The presence of the formyl group suggests potential for further reactions, such as condensation or reduction. This compound may exhibit biological activity, making it of interest in pharmaceutical research or agrochemical applications. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 2-(2-Chloro-4-formyl-6-methoxyphenoxy)propanoic acid represents a versatile structure for further exploration in synthetic and medicinal chemistry.

Formula: C₁₁H₁₁ClO₅

InChI: InChI=1S/C11H11ClO5/c1-6(11(14)15)17-10-8(12)3-7(5-13)4-9(10)16-2/h3-6H,1-2H3,(H,14,15)

InChI key: InChIKey=AHSGDLPBDMUJBG-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)C)C1=C(OC)C=C(C=O)C=C1Cl

Synonyms:

• 2-(2-Chloro-4-formyl-6-methoxyphenoxy)propanoic acid
• Propanoic acid, 2-(2-chloro-4-formyl-6-methoxyphenoxy)-

2-(2-Chloro-4-formyl-6-methoxyphenoxy)propanoic acid

CAS: 590395-58-7

Versatile small molecule scaffold

Formula: C₁₁H₁₁ClO₅

Purity: Min. 95%

Molecular weight: 258.65 g/mol

Ref: 3D-QYA39558