CAS 590395-59-8

2-(4-chloro-2-formyl-6-methoxyphenoxy)propanoic acid

Description:

2-(4-chloro-2-formyl-6-methoxyphenoxy)propanoic acid, with the CAS number 590395-59-8, is an organic compound characterized by its complex structure that includes a phenoxy group, a chloro substituent, and a formyl group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which may influence its solubility, reactivity, and potential biological activity. The presence of the chloro group can enhance the compound's electrophilicity, while the methoxy group may contribute to its overall stability and hydrophobic character. As a propanoic acid derivative, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of herbicides or other bioactive agents. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise details.

Formula: C₁₁H₁₁ClO₅

InChI: InChI=1/C11H11ClO5/c1-6(11(14)15)17-10-7(5-13)3-8(12)4-9(10)16-2/h3-6H,1-2H3,(H,14,15)

SMILES: CC(C(=O)O)Oc1c(cc(cc1OC)Cl)C=O