CymitQuimica logo

CAS 5904-70-1

:

2,5-Dihydro-2-hydroxy-5-nitro-2-furanMethanediol Triacetate

Description:
2,5-Dihydro-2-hydroxy-5-nitro-2-furanmethanediol triacetate, identified by its CAS number 5904-70-1, is a chemical compound that features a furan ring with various functional groups, including hydroxyl and nitro groups. This compound is characterized by its triacetate form, which indicates the presence of three acetate groups attached to the furan structure. The presence of the nitro group suggests potential reactivity and applications in organic synthesis or as an intermediate in the production of other chemical compounds. The hydroxyl group contributes to its solubility in polar solvents and may influence its reactivity in various chemical reactions. Additionally, the furan ring structure is known for its aromatic properties, which can affect the compound's stability and interactions with other molecules. Overall, this compound's unique combination of functional groups and structural features may lend itself to specific applications in pharmaceuticals, agrochemicals, or materials science, although detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C11H13NO9
InChI:InChI=1S/C11H13NO9/c1-6(13)18-10(19-7(2)14)11(20-8(3)15)5-4-9(21-11)12(16)17/h4-5,9-10H,1-3H3
InChI key:OQQARHHKPBGAGA-UHFFFAOYSA-N
SMILES:CC(=O)OC(C1(C=CC(O1)[N+](=O)[O-])OC(=O)C)OC(=O)C
Synonyms:
  • Methanediol, 1-[2-(acetyloxy)-2,5-dihydro-5-nitro-2-furanyl]-, 1,1-diacetate
  • Nifuratel impurities9
  • 1-[2-(acetyloxy)-2,5-dihydro-5-nitro-2-furanyl]-1,1-diacetate Methanediol
  • 2,5-Dihydro-2-hydroxy-5-nitro-2-furanMethanediol Triacetate
  • (2-Acetoxy-5-nitro-2,5-dihydrofuran-2-yl)methylene Diacetate
Found 2 products.