CAS 590417-93-9

4-bromo-2-methyl-2H-indazole

Description:

4-Bromo-2-methyl-2H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 4-position and a methyl group at the 2-position contributes to its unique properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic nature. It is often used in medicinal chemistry and research due to its potential biological activity, including anti-inflammatory and anticancer properties. The molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, 4-bromo-2-methyl-2H-indazole can undergo various chemical reactions, such as substitution and coupling, which are valuable in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound represents a significant area of study in both synthetic and medicinal chemistry.

Formula: C₈H₇BrN₂

InChI: InChI=1/C8H7BrN2/c1-11-5-6-7(9)3-2-4-8(6)10-11/h2-5H,1H3

SMILES: Cn1cc2c(cccc2n1)Br

Synonyms:

• 2H-Indazole, 4-bromo-2-methyl-
• 2-Methyl-4-bromoindazole
• -BROMO-2-METHYL-2H-INDAZOLE
• 4-BROMO-2-METHYL-2H-INDAZOLE
• 4-Bromo-2-methylindazole

4-Bromo-2-methyl-2H-indazole

CAS: 590417-93-9

Formula: C₈H₇BrN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 211.0586

Ref: IN-DA00E9OW

4-Bromo-2-methyl-2H-indazole

CAS: 590417-93-9

4-Bromo-2-methyl-2H-indazole

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 211.06g/mol

Ref: 54-OR60016

4-Bromo-2-methyl-2H-indazole

CAS: 590417-93-9

Formula: C₈H₇BrN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 211.062

Ref: 10-F236565