CAS 590417-94-0

6-Bromo-1-methyl-1H-indazole

Description:

6-Bromo-1-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 6-position and a methyl group at the 1-position contributes to its unique properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for various interactions, making it a candidate for studies in biological activity, including anti-inflammatory and anticancer properties. The compound's solubility can vary depending on the solvent, and it may exhibit moderate stability under standard conditions. As with many brominated compounds, it is essential to handle 6-Bromo-1-methyl-1H-indazole with care due to potential toxicity and environmental concerns associated with bromine-containing substances. Proper safety protocols should be followed when working with this compound in laboratory settings.

Formula: C₈H₇BrN₂

InChI: InChI=1/C8H7BrN2/c1-11-8-4-7(9)3-2-6(8)5-10-11/h2-5H,1H3

SMILES: Cn1c2cc(ccc2cn1)Br

Synonyms:

• 1H-Indazole, 6-bromo-1-methyl-
• 6-Bromo-1-methyl-1H-idazole
• 6-Bromo-1-methylindazole
• 6-bromo-1-methyl-3a,7a-dihydro-1H-indazole
• 6-BROMO-1-METHYL-1H-INDAZOLE
• 1-Methyl-6-bromoindazole

6-Bromo-1-methyl-1H-indazole

CAS: 590417-94-0

Formula: C₈H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 211.0586

Ref: IN-DA003N3K

6-Bromo-1-methyl-1H-indazole

CAS: 590417-94-0

6-Bromo-1-methyl-1H-indazole

Formula: C₈H₇BrN₂

Purity: 98%

Color and Shape: Off-White Solid

Molecular weight: 211.06g/mol

Ref: 54-OR43569

6-Bromo-1-methyl-1H-indazole

CAS: 590417-94-0

Formula: C₈H₇BrN₂

Purity: 98%

Color and Shape: Solid, Powder

Molecular weight: 211.062

Ref: 10-F046455

6-Bromo-1-methylindazole

CAS: 590417-94-0

6-Bromo-1-methylindazole is an industrial chemical that can be synthesized by the reaction of formate, methanol, and indazole. The synthesis method involves the esterification of methyl formate with indazole to produce 6-bromo-1-methylindazole. It can also be synthesized by the annulation of methyl formate and cyclopentadiene followed by hydrolysis. This chemical has several isomers that are distinguished from each other based on their synthesis methods. 6-Bromo-1-methylindazole has been shown to have a hydrolysis reaction when it reacts with water, producing methyl bromide and hydrogen bromide.

Formula: C₈H₇BrN₂

Purity: Min. 95%

Molecular weight: 211.06 g/mol

Ref: 3D-FB54481