CAS 590418-08-9

(1-methyl-1H-indazol-5-yl)boronic acid

Description:

(1-Methyl-1H-indazol-5-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to an indazole ring system. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under standard laboratory conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Its structure includes a methyl group at the 1-position of the indazole, which can influence its reactivity and interaction with biological targets. Additionally, the compound may exhibit potential biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as boronic acids can be sensitive to moisture and may require specific precautions. Overall, (1-methyl-1H-indazol-5-yl)boronic acid is a versatile compound with applications in synthetic chemistry and drug development.

Formula: C₈H₉BN₂O₂

InChI: InChI=1/C8H9BN2O2/c1-11-8-3-2-7(9(12)13)4-6(8)5-10-11/h2-5,12-13H,1H3

SMILES: Cn1c2ccc(cc2cn1)B(O)O

Synonyms:

• 1-methyl-1H-indazol-5-ylboronic acid
• Boronic acid, B-(1-methyl-1H-indazol-5-yl)-
• 1-Methylindazol-5-boronicacid

1-Methylindazole-5-boronic acid

CAS: 590418-08-9

Formula: C₈H₉BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.9803

Ref: IN-DA0038MM

1-Methyl-1H-indazole-5-boronic acid

CAS: 590418-08-9

1-Methyl-1H-indazole-5-boronic acid

Formula: C₈H₉BN₂O₂

Purity: 98%

Color and Shape: white solid

Molecular weight: 175.98g/mol

Ref: 54-OR30587

1-Methyl-1H-indazol-5-yl-5-boronic acid

CAS: 590418-08-9

Formula: C₈H₉BN₂O₂

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 175.98

Ref: 10-F078322