CAS 59046-72-9

2-(phenylethynyl)benzaldehyde

Description:

2-(Phenylethynyl)benzaldehyde, with the CAS number 59046-72-9, is an organic compound characterized by its distinctive structure, which features a benzaldehyde group attached to a phenylethynyl moiety. This compound typically appears as a yellow to brownish solid and is known for its aromatic properties due to the presence of multiple benzene rings. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. The compound is of interest in organic synthesis and materials science, particularly in the development of fluorescent dyes and as a building block in the synthesis of more complex organic molecules. Its reactivity is influenced by the presence of the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, 2-(phenylethynyl)benzaldehyde may exhibit interesting photophysical properties, making it a candidate for applications in optoelectronic devices. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.

Formula: C₁₅H₁₀O

InChI: InChI=1/C15H10O/c16-12-15-9-5-4-8-14(15)11-10-13-6-2-1-3-7-13/h1-9,12H

SMILES: c1ccc(cc1)C#Cc1ccccc1C=O

2-PHENYLETHYNYL-BENZALDEHYDE

CAS: 59046-72-9

Formula: C₁₅H₁₀O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 206.2393

Ref: IN-DA00ECL8

2-(Phenylethynyl)benzaldehyde

CAS: 59046-72-9

2-(Phenylethynyl)benzaldehyde

Formula: C₁₅H₁₀O

Purity: tech

Color and Shape: clear. very dark red/brown liquid

Molecular weight: 206.24g/mol

Ref: 54-OR958562

2-(Phenylethynyl)benzaldehyde

CAS: 59046-72-9

Formula: C₁₅H₁₀O

Purity: >98.0%(HPLC)

Color and Shape: Colorless to Yellow to Orange clear liquid

Molecular weight: 206.24

Ref: 3B-P2914

2-(Phenylethynyl)benzaldehyde

CAS: 59046-72-9

Formula: C₁₅H₁₀O

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.244

Ref: 10-F308475