CAS 5905-00-0
:2,2'-bifuran
Description:
2,2'-Bifuran, with the CAS number 5905-00-0, is an organic compound characterized by its unique structure, which consists of two furan rings connected by a single bond. This compound is a colorless to pale yellow solid at room temperature and is known for its aromatic properties. It has a relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. 2,2'-Bifuran exhibits interesting chemical reactivity, including the ability to undergo oxidation and polymerization, making it a subject of interest in organic synthesis and materials science. Its molecular formula is C10H8O2, and it has a moderate melting point. The compound is also noted for its potential applications in the development of organic semiconductors and as a building block in the synthesis of various organic materials. However, safety precautions should be taken when handling it, as it may pose health risks if inhaled or ingested.
Formula:C8H6O2
InChI:InChI=1/C8H6O2/c1-3-7(9-5-1)8-4-2-6-10-8/h1-6H
SMILES:c1cc(c2ccco2)oc1
Synonyms:- 2,2'-Bifuryl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,2'-Bifuran
CAS:<p>2,2'-Bifuran is a synthetic compound with a carbonyl group and fluoro substituents. The carbonyl group of 2,2'-bifuran participates in reversible oxidation reactions with the cationic polymerization initiator, which leads to the formation of polymers. The presence of fluoro substituents on the bifuran ring is important for these reactions because they allow for steric interactions with neighboring groups during polymerization. This reaction is highly scalable due to the simple synthesis and inexpensive reagents needed to produce it. 2,2'-Bifuran has been used as an initiator in diagnostic tests and as a structural formula for other compounds.</p>Formula:C8H6O2Purity:Min. 95%Molecular weight:134.13 g/mol
