CAS 59080-18-1
:Naphthalene, 1-fluoro-4-(methylsulfonyl)-
Description:
Naphthalene, 1-fluoro-4-(methylsulfonyl)-, also known by its CAS number 59080-18-1, is an organic compound characterized by its naphthalene backbone substituted with a fluorine atom and a methylsulfonyl group. This compound typically appears as a colorless to pale yellow solid with a distinctive aromatic odor. It is soluble in organic solvents such as acetone and ethanol but has limited solubility in water. The presence of the fluorine atom enhances its reactivity and can influence its biological activity, while the methylsulfonyl group contributes to its polar characteristics. Naphthalene derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and materials science due to their unique electronic properties and potential for functionalization. Safety considerations include handling precautions due to its potential toxicity and environmental impact, as well as its classification as a possible carcinogen. Overall, this compound exemplifies the diverse chemistry of substituted aromatic compounds and their relevance in various industrial applications.
Formula:C11H9FO2S
InChI:InChI=1S/C11H9FO2S/c1-15(13,14)11-7-6-10(12)8-4-2-3-5-9(8)11/h2-7H,1H3
InChI key:InChIKey=BFJDLILZBCRIPN-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C=1C2=C(C(F)=CC1)C=CC=C2
Synonyms:- 1-Fluoro-4-(methylsulfonyl)naphthalene
- 1-Fluoro-4-naphthyl methylsulfone
- 1-Fluoro-4-methylsulfonylnaphthalene
- Naphthalene, 1-fluoro-4-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
