CAS 59086-27-0

ethyl 4-oxo-4-pyridin-3-ylbutanoate

Description:

Ethyl 4-oxo-4-pyridin-3-ylbutanoate is a chemical compound characterized by its unique structure, which includes a pyridine ring and a butanoate moiety. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in medicinal chemistry and organic synthesis. The presence of the pyridine ring contributes to its aromatic properties, while the butanoate group enhances its reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, such as esterification or nucleophilic substitution. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling ethyl 4-oxo-4-pyridin-3-ylbutanoate, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-2-15-11(14)6-5-10(13)9-4-3-7-12-8-9/h3-4,7-8H,2,5-6H2,1H3

SMILES: CCOC(=O)CCC(=O)c1cccnc1

Ethyl 4-oxo-4-(3-pyridyl)butyrate

CAS: 59086-27-0

Formula: C₁₁H₁₃NO₃

Purity: 97.0%

Color and Shape: Liquid, Oil

Molecular weight: 207.229

Ref: 10-F207881

Ethyl 4-Oxo-4-(3-pyridyl)butanoate

Controlled Product

CAS: 59086-27-0

Stability Stable at RT (under Argon)
Applications Precursor of N-substituted cotinine analogues as well as norcotinine.
References J. Org. Chem., 43, 2860 (1978)

Formula: C₁₁H₁₃NO₃

Color and Shape: Neat

Molecular weight: 207.23

Ref: TR-E925400