CAS 59086-52-1

2-(prop-2-en-1-yloxy)benzoic acid

Description:

2-(Prop-2-en-1-yloxy)benzoic acid, also known by its CAS number 59086-52-1, is an organic compound characterized by the presence of both a benzoic acid moiety and an allyloxy group. This compound features a benzene ring substituted with a carboxylic acid group (-COOH) and an allyloxy group (-O-CH=CH2) at the ortho position. The presence of the allyl group imparts unique reactivity, making it suitable for various applications in organic synthesis and polymer chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups allow for potential participation in reactions such as esterification, polymerization, and cross-linking, which are valuable in the development of new materials. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Overall, 2-(prop-2-en-1-yloxy)benzoic acid is a versatile compound with significant implications in both industrial and research settings.

Formula: C₁₀H₁₀O₃

InChI: InChI=1/C10H10O3/c1-2-7-13-9-6-4-3-5-8(9)10(11)12/h2-6H,1,7H2,(H,11,12)

SMILES: C=CCOc1ccccc1C(=O)O

2-(Allyloxy)benzoic acid

CAS: 59086-52-1

Formula: C₁₀H₁₀O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.1846

Ref: IN-DA00EDXA

2-(Prop-2-en-1-yloxy)benzoic acid

CAS: 59086-52-1

2-(Prop-2-en-1-yloxy)benzoic acid

Purity: 98%

Molecular weight: 178.18g/mol

Ref: 54-OR91659

2-(Prop-2-en-1-yloxy)benzoic acid

CAS: 59086-52-1

Purity: 98%

Molecular weight: 178.1869965

Ref: 10-F660964

2-(Prop-2-en-1-yloxy)benzoic acid

CAS: 59086-52-1

2-(Prop-2-en-1-yloxy)benzoic acid is a chemical compound that is used as an antimicrobial agent. It has been shown to have a broad spectrum of activity against bacteria, fungi, and viruses. In particular, it is active against organisms that are resistant to penicillin. This drug has been shown to be effective against methicillin-resistant Staphylococcus aureus (MRSA) and Clostridium perfringens, although is not active against acid-fast bacteria such as Mycobacterium tuberculosis or Mycobacterium avium complex. 2-(Prop-2-en-1-yloxy)benzoic acid has also been shown to have antiinflammatory properties which may be due to its inhibition of prostaglandin synthesis.

Formula: C₁₀H₁₀O₃

Purity: Min. 95%

Molecular weight: 178.18 g/mol

Ref: 3D-JCA08652