CAS 59086-93-0
:6-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(13H)-one
Description:
6-Hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(13H)-one, with the CAS number 59086-93-0, is a complex organic compound belonging to the class of flavonoids. This substance features a chromone backbone, characterized by its fused aromatic rings and multiple methoxy groups, which contribute to its chemical stability and potential biological activity. The presence of hydroxyl and methoxy functional groups enhances its solubility and reactivity, making it a subject of interest in medicinal chemistry. It may exhibit various pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities, although specific biological effects would depend on further empirical studies. The compound's structural complexity suggests potential applications in drug development and natural product chemistry. As with many flavonoids, it may also play a role in plant pigmentation and UV protection. Proper handling and storage conditions are essential to maintain its integrity and prevent degradation.
Formula:C23H20O7
InChI:InChI=1/C23H20O7/c1-23(2)6-5-11-15(30-23)8-13(24)20-21(25)19-12-7-16(26-3)17(27-4)9-14(12)28-10-18(19)29-22(11)20/h5-9,24H,10H2,1-4H3
SMILES:CC1(C)C=Cc2c(cc(c3c(=O)c4c5cc(c(cc5OCc4oc23)OC)OC)O)O1
Synonyms:- 3H-[1]benzopyrano[3,4-b]pyrano[2,3-h][1]benzopyran-7(13H)-one, 6-hydroxy-9,10-dimethoxy-3,3-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,3-Dimethyl-6-hydroxy-9,10-dimethoxy-3H-bis[1]benzopyrano[3,4-b
CAS:Formula:C23H20O7Molecular weight:408.4007Dehydrotoxicarol
CAS:Dehydrotoxicarol is a natural product of Derris, Fabaceae.Formula:C23H20O7Purity:98%Color and Shape:SolidMolecular weight:408.4Dehydrotoxicarol
CAS:Formula:C23H20O7Purity:95%~99%Color and Shape:Yellow powderMolecular weight:408.406Dehydrotoxicarol
CAS:<p>Dehydrotoxicarol is a toxic plant alkaloid, which is an organic compound derived from certain plant species. It possesses a complex molecular structure typical of alkaloids, characterized by nitrogen atoms in heterocyclic rings. This compound is sourced specifically from the roots of the plant known for its toxic properties. Dehydrotoxicarol exerts its effects by interfering with cellular processes, often by binding to specific proteins or disrupting membrane integrity, leading to cellular dysfunction or death.</p>Formula:C23H20O7Purity:Min. 95%Molecular weight:408.4 g/mol




