CymitQuimica logo

CAS 59099-58-0

:

Methanesulfonic acid, trifluoro-, 2-methoxyphenyl ester

Description:
Methanesulfonic acid, trifluoro-, 2-methoxyphenyl ester, with the CAS number 59099-58-0, is an organic compound characterized by its ester functional group derived from methanesulfonic acid and 2-methoxyphenol. This compound typically exhibits properties associated with both sulfonic acids and esters, including high solubility in polar solvents due to the presence of the sulfonic acid moiety. The trifluoromethyl group contributes to its unique reactivity and stability, often enhancing its lipophilicity and influencing its interaction with biological systems. The 2-methoxyphenyl group provides aromatic characteristics, which can affect the compound's electronic properties and potential applications in organic synthesis or as a reagent in chemical reactions. Methanesulfonic acid derivatives are known for their utility in various chemical processes, including catalysis and as intermediates in the synthesis of pharmaceuticals. Safety data should be consulted, as compounds with trifluoromethyl groups can exhibit specific toxicological profiles. Overall, this compound represents a versatile structure with potential applications in both industrial and research settings.
Formula:C8H7F3O4S
InChI:InChI=1S/C8H7F3O4S/c1-14-6-4-2-3-5-7(6)15-16(12,13)8(9,10)11/h2-5H,1H3
InChI key:RCDZTJFBROIDKD-UHFFFAOYSA-N
SMILES:COC1=CC=CC=C1OS(=O)(=O)C(F)(F)F
Found 5 products.