CAS 5910-88-3
:(2Z,4E)-2,4-Decadienal
Description:
(2Z,4E)-2,4-Decadienal, with the CAS number 5910-88-3, is an organic compound characterized by its long carbon chain and specific geometric isomerism. It features a linear structure with a total of ten carbon atoms and two double bonds located at the second and fourth positions, which are in the Z (cis) and E (trans) configurations, respectively. This compound is a type of aldehyde, indicated by the presence of a carbonyl group (C=O) at one end of the carbon chain. It is typically a colorless to pale yellow liquid with a distinctive odor, often described as fatty or waxy, which makes it of interest in flavor and fragrance applications. (2Z,4E)-2,4-Decadienal is also known for its potential use in the synthesis of various chemical intermediates and its role in biological systems, where it may exhibit antimicrobial properties. Its reactivity is influenced by the presence of the double bonds and the aldehyde functional group, making it a versatile compound in organic synthesis.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c1-2-3-4-5-6-7-8-9-10-11/h6-10H,2-5H2,1H3/b7-6+,9-8-
InChI key:InChIKey=JZQKTMZYLHNFPL-MUIOLIGRSA-N
SMILES:C(\CCCCC)=C/C=C\C=O
Synonyms:- 2,4-Decadienal, (Z,E)-
- (2Z,4E)-2,4-Decadienal
- 2,4-Decadienal, (2Z,4E)-
- cis,trans-2,4-Decadienal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
