CymitQuimica logo

CAS 59105-50-9

:

Methanone, (5-bromo-3-pyridinyl)phenyl-

Description:
Methanone, (5-bromo-3-pyridinyl)phenyl-, also known by its CAS number 59105-50-9, is an organic compound characterized by its structure, which includes a phenyl group and a pyridine ring substituted with a bromine atom. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and reactivity due to the presence of the carbonyl group (C=O) in the methanone functional group. The bromine substitution can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the pyridine ring may impart basicity and influence solubility in polar solvents. Methanone derivatives are often studied for their potential applications in pharmaceuticals and agrochemicals, as they can serve as intermediates in the synthesis of more complex molecules. Overall, this compound exemplifies the diverse chemistry of substituted aromatic and heterocyclic systems.
Formula:C12H8BrNO
InChI:InChI=1S/C12H8BrNO/c13-11-6-10(7-14-8-11)12(15)9-4-2-1-3-5-9/h1-8H
InChI key:JBMAMZKKOFXEDT-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(=O)C2=CC(=CN=C2)Br
Found 4 products.