CAS 59108-53-1
:(3R)-3,4-dihydro-2H-chromen-3-amine
Description:
(3R)-3,4-Dihydro-2H-chromen-3-amine is a chemical compound characterized by its bicyclic structure, which includes a chromene moiety. This compound features a chiral center at the 3-position, contributing to its stereochemistry. The presence of an amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The dihydrochromene structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its molecular interactions can be influenced by the stereochemistry, which may affect its binding affinity to biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, (3R)-3,4-dihydro-2H-chromen-3-amine represents a class of compounds that may have significant implications in both synthetic and medicinal chemistry.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-4,8H,5-6,10H2/t8-/m1/s1
SMILES:c1ccc2c(c1)C[C@H](CO2)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.