CAS 5912-18-5
:4,6-dichloro-1H-pyrrolo[2,3-b]pyridine
Description:
4,6-Dichloro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two chlorine substituents at the 4 and 6 positions of the pyrrolo ring, enhancing its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. The presence of chlorine atoms can influence its electronic properties, making it a candidate for use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, which is of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4,6-dichloro-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in both research and industrial applications.
Formula:C7H4Cl2N2
InChI:InChI=1/C7H4Cl2N2/c8-5-3-6(9)11-7-4(5)1-2-10-7/h1-3H,(H,10,11)
SMILES:c1c[nH]c2c1c(cc(Cl)n2)Cl
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 4,6-dichloro-
- 4,6-Dichlor-1H-pyrrolo[2,3-b]pyridin
- 4,6-dichloro-7-azaindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrrolo[2,3-b]pyridine, 4,6-dichloro-
CAS:Formula:C7H4Cl2N2Purity:96%Color and Shape:SolidMolecular weight:187.0261Ref: IN-DA00E9P0
1g57.00€5g119.00€10g159.00€1kgTo inquire25g511.00€50gTo inquire5kgTo inquire100gTo inquire500gTo inquire100mg28.00€250mg32.00€4,6-Dichloro-7-azaindole
CAS:4,6-Dichloro-7-azaindolePurity:98%Color and Shape:SolidMolecular weight:187.03g/mol4,6-Dichloro-1H-pyrrolo[2,3-b]pyridine
CAS:4,6-Dichloro-1H-pyrrolo[2,3-b]pyridine is a nucleophilic reagent that can be used in the synthesis of 7-azaindole derivatives. It has been shown to react efficiently with phenolates and other nucleophiles. 4,6-Dichloro-1H-pyrrolo[2,3-b]pyridine reacts with activated methylene compounds by forming a three membered ring. This reaction is efficient and produces high yields.Formula:C7H4Cl2N2Purity:Min. 95%Color and Shape:White To Yellow SolidMolecular weight:187.03 g/mol



