CAS 591224-55-4

3-[(2-chloro-6-fluorobenzyl)oxy]-4-methoxybenzaldehyde

Description:

3-[(2-Chloro-6-fluorobenzyl)oxy]-4-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a methoxy group and a benzaldehyde functional group. The presence of the chloro and fluoro substituents on the benzyl moiety contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic aromatic rings and polar functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated compounds often exhibit enhanced biological activity. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, due to the reactive aldehyde group. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, 3-[(2-chloro-6-fluorobenzyl)oxy]-4-methoxybenzaldehyde is a noteworthy compound for further study in both synthetic and applied chemistry contexts.

Formula: C₁₅H₁₂ClFO₃

InChI: InChI=1/C15H12ClFO3/c1-19-14-6-5-10(8-18)7-15(14)20-9-11-12(16)3-2-4-13(11)17/h2-8H,9H2,1H3

SMILES: COc1ccc(cc1OCc1c(cccc1F)Cl)C=O

Synonyms:

• Benzaldehyde, 3-[(2-Chloro-6-Fluorophenyl)Methoxy]-4-Methoxy-

3-[(2-chloro-6-fluorobenzyl)oxy]-4-methoxybenzaldehyde

CAS: 591224-55-4

Formula: C₁₅H₁₂ClFO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 294.71

Ref: 10-F307596