CymitQuimica logo

CAS 59132-30-8

:

2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-1,3-dicarboxylic acid

Description:
2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-1,3-dicarboxylic acid, with the CAS number 59132-30-8, is a bicyclic compound that features a pyridoindole structure. This substance is characterized by its fused ring system, which includes a pyridine and an indole moiety, contributing to its unique chemical properties. The presence of two carboxylic acid groups at the 1 and 3 positions enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. The compound is typically studied for its potential biological activities, including neuroprotective effects and interactions with neurotransmitter systems. Its structural complexity allows for diverse reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit interesting spectroscopic properties, which can be utilized in analytical chemistry for identification and quantification. Overall, 2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-1,3-dicarboxylic acid is a significant compound in the realm of organic and medicinal chemistry.
Formula:C13H12N2O4
InChI:InChI=1S/C13H12N2O4/c16-12(17)9-5-7-6-3-1-2-4-8(6)14-10(7)11(15-9)13(18)19/h1-4,9,11,14-15H,5H2,(H,16,17)(H,18,19)
InChI key:InChIKey=ZWMZDKZTZLGVRQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C2=C(C=3C(N2)=CC=CC3)CC(C(O)=O)N1
Synonyms:
  • 2,3,4,9-Tetrahydro-1H-β-carboline-1,3-dicarboxylic acid
  • 1,2,3,4-Tetrahydro-β-carboline-1,3-dicarboxylic acid
  • 2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-1,3-dicarboxylic acid
  • NSC 298850
  • 1H-Pyrido[3,4-b]indole-1,3-dicarboxylic acid, 2,3,4,9-tetrahydro-
Found 5 products.