CAS 59142-47-1

2-Bromo-α-phenylbenzenemethanol

Description:

2-Bromo-α-phenylbenzenemethanol, also known by its CAS number 59142-47-1, is an organic compound characterized by the presence of a bromine atom and a hydroxymethyl group attached to a phenyl ring. This compound features a biphenyl structure, where one of the phenyl groups is substituted with a bromine atom, enhancing its reactivity and potential applications in organic synthesis. The hydroxymethyl group (-CH2OH) contributes to its solubility in polar solvents and can participate in various chemical reactions, such as oxidation or substitution. The presence of the bromine atom makes it a valuable intermediate in the synthesis of other organic compounds, including pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential for hydrogen bonding due to the hydroxyl group, which may influence its physical properties, such as boiling point and melting point. Overall, 2-Bromo-α-phenylbenzenemethanol is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₁₃H₁₁BrO

InChI: InChI=1S/C13H11BrO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9,13,15H

InChI key: InChIKey=PFNIDHUYBLYJGE-UHFFFAOYSA-N

SMILES: C(O)(C1=C(Br)C=CC=C1)C2=CC=CC=C2

Synonyms:

• Benzhydrol, 2-bromo-
• 2-Bromobenzhydrol
• (2-Bromophenyl)phenylmethanol
• Benzenemethanol, 2-bromo-α-phenyl-
• 2-Bromo-α-phenylbenzenemethanol
• (2-BROMOPHENYL)(PHENYL)METHANOL

(2-bromophenyl)(phenyl)methanol

CAS: 59142-47-1

Formula: C₁₃H₁₁BrO

Purity: 95%

Molecular weight: 263.1298

Ref: IN-DA01AJEL

(2-Bromophenyl)(phenyl)methanol

CAS: 59142-47-1

The synthesis of (2-bromophenyl)(phenyl)methanol is accomplished by the reaction of an aldehyde with bromine followed by an alkylation with magnesium. The product is obtained as a racemic mixture of enantiomers with a chiral center, which can be resolved by fractional crystallization or other separation methods. This method has been shown to be efficient for the synthesis of alcohols and carbinols, and stereogenic reactions.

Formula: C₁₃H₁₁OBr

Purity: Min. 95%

Molecular weight: 263.12 g/mol

Ref: 3D-JCA14247