CAS 59142-68-6
:2-Bromo-4-fluorobenzaldehyde
Description:
2-Bromo-4-fluorobenzaldehyde is an aromatic aldehyde characterized by the presence of both bromine and fluorine substituents on a benzene ring. Specifically, the bromine atom is located at the second position and the fluorine atom at the fourth position relative to the aldehyde functional group. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and temperature. It has a distinct aromatic odor, common to many benzaldehyde derivatives. The presence of halogens in its structure can influence its reactivity, making it useful in various organic synthesis applications, including the preparation of pharmaceuticals and agrochemicals. 2-Bromo-4-fluorobenzaldehyde is also notable for its potential in cross-coupling reactions and as an intermediate in the synthesis of more complex organic molecules. Its physical properties, such as boiling point and solubility, are influenced by the electronegative halogen substituents, which can affect the compound's polarity and overall reactivity. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.
Formula:C7H4BrFO
InChI:InChI=1S/C7H4BrFO/c8-7-3-6(9)2-1-5(7)4-10/h1-4H
InChI key:InChIKey=OPZDXMCOWFPQPE-UHFFFAOYSA-N
SMILES:C(=O)C1=C(Br)C=C(F)C=C1
Synonyms:- 4-Fluoro-2-bromobenzaldehyde
- Benzaldehyde,2-bromo-4-fluoro-
- 2-Bromo-4-fluorobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-4-fluorobenzaldehyde
CAS:Formula:C7H4BrFOPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:203.012-BROMO-4-FLUOROBENZALDEHYDE
CAS:Formula:C7H4BrFOPurity:99%Color and Shape:SolidMolecular weight:203.0085Ref: IN-DA00365M
1g20.00€5g24.00€10g28.00€1kg280.00€25g28.00€50g50.00€5kgTo inquire100g60.00€250g115.00€500g160.00€1000g281.00€2-Bromo-4-fluorobenzaldehyde
CAS:2-Bromo-4-fluorobenzaldehydeFormula:C7H4BrFOPurity:≥95%Color and Shape: white crystalline solidMolecular weight:203.01g/mol2-Bromo-4-fluorobenzaldehyde
CAS:2-Bromo-4-fluorobenzaldehyde is a hexacyclic compound that has been shown to have antibacterial activity against some bacterial strains. This chemical is known to be a potent inhibitor of β-lactamase enzymes. It has also been shown to inhibit the growth of bacteria that are resistant to other antibiotics, such as penicillin and erythromycin. 2-Bromo-4-fluorobenzaldehyde has been found in high levels in the urine of patients with hepatitis B or C, indicating that it may play a role in the pathogenesis of these diseases. High performance liquid chromatography (HPLC) is an efficient method for determining the purity of this drug substance. 2-Bromo-4-fluorobenzaldehyde may be used as an intermediate in the synthesis of naphthyridine drugs, which are potent inhibitors of protein synthesis.Formula:C7H4OBrFPurity:Min. 95%Color and Shape:PowderMolecular weight:203.01 g/mol2-Bromo-4-fluorobenzaldehyde
CAS:Formula:C7H4BrFOPurity:98%Color and Shape:SolidMolecular weight:203.01




