CAS 5915-16-2

[1,2,4]triazolo[1,5-a]pyrimidin-7-amine

Description:

[1,2,4]Triazolo[1,5-a]pyrimidin-7-amine is a heterocyclic compound characterized by its fused triazole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid-state structure and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the amino group at the 7-position enhances its reactivity and solubility in polar solvents. It may participate in hydrogen bonding due to the amino group, influencing its interactions with biological targets. The compound's structure allows for various substitutions, which can modify its pharmacological properties. Additionally, [1,2,4]triazolo[1,5-a]pyrimidin-7-amine may exhibit properties such as moderate to high melting points and stability under standard laboratory conditions. Its applications can range from pharmaceuticals to agrochemicals, depending on the specific derivatives and modifications made to the core structure. Overall, this compound represents a versatile scaffold in the development of new therapeutic agents.

Formula: C₅H₅N₅

InChI: InChI=1/C5H5N5/c6-4-1-2-7-5-8-3-9-10(4)5/h1-3H,6H2

SMILES: c1cnc2ncnn2c1N

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidin-7-amine
• [1,2,4]triazolo[1,5-a]pyrimidin-7-ylamine
• [1,2,4]triazolo[5,1-b]pyrimidin-7-ylamine
• [1,2,4]triazolo[5,1-b]pyrimidin-7-amine
• 1,5,7,9-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraen-2-amine

[1,2,4]Triazolo[1,5-a]pyriMidin-7-aMine

CAS: 5915-16-2

Formula: C₅H₅N₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.1267

Ref: IN-DA003CQL

[1,2,4]Triazolo[1,5-a]pyrimidin-7-amine

CAS: 5915-16-2

[1,2,4]Triazolo[1,5-a]pyrimidin-7-amine

Purity: 95%

Molecular weight: 135.13g/mol

Ref: 54-OR1002790

[1,2,4]Triazolo[1,5-a]pyrimidin-7-amine

CAS: 5915-16-2

Formula: C₅H₅N₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.13

Ref: 10-F065076

[1,2,4]Triazolo[1,5-a]pyrimidin-7-amine

CAS: 5915-16-2

[1,2,4]Triazolo[1,5-a]pyrimidin-7-amine is a competitive inhibitor of tumor growth. It has been shown to inhibit the synthesis of DNA and RNA by binding to the N7 nitrogen atom in the nucleotide base. The compound also has a trifluoromethyl group that can be used as an assay for enzymatic activity. [1,2,4]Triazolo[1,5-a]pyrimidin-7-amine can be synthesized from 2-(3'-hydroxypropoxy)phenylamine by reaction with hydroxylamine and formaldehyde in the presence of sodium cyanide. This drug inhibits tumor growth in vitro and in vivo and is active against infectious diseases such as hepatitis B virus (HBV).

Formula: C₅H₅N₅

Purity: Min. 95%

Molecular weight: 135.13 g/mol

Ref: 3D-FT126840